C13H16O4 — CID 101360976
(1S,2S,8R)-7,7-dimethoxy-5-methyl-11-oxatricyclo[6.2.1.02,6]undeca-5,9-dien-4-one (PubChem CID 101360976) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (1S,2S,8R)-7,7-dimethoxy-5-methyl-11-oxatricyclo[6.2.1.02,6]undeca-5,9-dien-4-one.
| Compound Name | (1S,2S,8R)-7,7-dimethoxy-5-methyl-11-oxatricyclo[6.2.1.02,6]undeca-5,9-dien-4-one |
|---|---|
| PubChem CID | 101360976 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (1S,2S,8R)-7,7-dimethoxy-5-methyl-11-oxatricyclo[6.2.1.02,6]undeca-5,9-dien-4-one |
| SMILES | COC1(OC)C2=C(C)C(=O)C[C@@H]2[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C13H16O4/c1-7-9(14)6-8-10-4-5-11(17-10)13(15-2,16-3)12(7)8/h4-5,8,10-11H,6H2,1-3H3/t8-,10+,11-/m1/s1 |
| InChIKey | KWIDGDAFXNEADC-DVVUODLYSA-N |
| XLogP | 1.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|