C13H16O5 — CID 10923001
(1R,2R,9S,10R,14R)-12,12-dimethyl-8,11,13,15-tetraoxatetracyclo[7.6.0.02,6.010,14]pentadec-5-en-4-one (PubChem CID 10923001) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is (1R,2R,9S,10R,14R)-12,12-dimethyl-8,11,13,15-tetraoxatetracyclo[7.6.0.02,6.010,14]pentadec-5-en-4-one.
| Compound Name | (1R,2R,9S,10R,14R)-12,12-dimethyl-8,11,13,15-tetraoxatetracyclo[7.6.0.02,6.010,14]pentadec-5-en-4-one |
|---|---|
| PubChem CID | 10923001 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (1R,2R,9S,10R,14R)-12,12-dimethyl-8,11,13,15-tetraoxatetracyclo[7.6.0.02,6.010,14]pentadec-5-en-4-one |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H](OCC4=CC(=O)C[C@H]43)[C@H]2O1 |
| InChI | InChI=1S/C13H16O5/c1-13(2)17-11-10-9(16-12(11)18-13)8-4-7(14)3-6(8)5-15-10/h3,8-12H,4-5H2,1-2H3/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | PZIOXKVRHFKRCQ-RMPHRYRLSA-N |
| XLogP | 0.78 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |