C22H36B2O4 — CID 101412129
2-[3-ethenyl-5-propan-2-ylidene-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopenten-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 101412129) has the molecular formula C22H36B2O4 and a molecular weight of 386.15 g/mol. Its IUPAC name is 2-[3-ethenyl-5-propan-2-ylidene-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopenten-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-ethenyl-5-propan-2-ylidene-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopenten-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 101412129 |
| Molecular Formula | C22H36B2O4 |
| Molecular Weight | 386.15 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 2-[3-ethenyl-5-propan-2-ylidene-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopenten-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=CC1CC(=C(C)C)C(B2OC(C)(C)C(C)(C)O2)=C1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H36B2O4/c1-12-15-13-16(14(2)3)18(24-27-21(8,9)22(10,11)28-24)17(15)23-25-19(4,5)20(6,7)26-23/h12,15H,1,13H2,2-11H3 |
| InChIKey | KUQQKJWXWWNFBX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.15 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|