C22H34O4 — CID 101412143
[5-[(1R,4S,6R,10S,12S)-4,12-dimethyl-9-methylidene-5-oxatricyclo[8.2.0.04,6]dodecan-12-yl]-2-methyl-5-oxopentan-2-yl] acetate (PubChem CID 101412143) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [5-[(1R,4S,6R,10S,12S)-4,12-dimethyl-9-methylidene-5-oxatricyclo[8.2.0.04,6]dodecan-12-yl]-2-methyl-5-oxopentan-2-yl] acetate.
| Compound Name | [5-[(1R,4S,6R,10S,12S)-4,12-dimethyl-9-methylidene-5-oxatricyclo[8.2.0.04,6]dodecan-12-yl]-2-methyl-5-oxopentan-2-yl] acetate |
|---|---|
| PubChem CID | 101412143 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [5-[(1R,4S,6R,10S,12S)-4,12-dimethyl-9-methylidene-5-oxatricyclo[8.2.0.04,6]dodecan-12-yl]-2-methyl-5-oxopentan-2-yl] acetate |
| SMILES | C=C1CC[C@H]2O[C@@]2(C)CC[C@@H]2[C@@H]1C[C@]2(C)C(=O)CCC(C)(C)OC(C)=O |
| InChI | InChI=1S/C22H34O4/c1-14-7-8-19-22(6,26-19)12-9-17-16(14)13-21(17,5)18(24)10-11-20(3,4)25-15(2)23/h16-17,19H,1,7-13H2,2-6H3/t16-,17-,19-,21+,22+/m1/s1 |
| InChIKey | DDLAWTMZVGTWMK-NDUFAUORSA-N |
| XLogP | 4.61 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|