C11H16O3 — CID 101413883
2-(3-hydroxy-3-methylpent-4-enyl)-3-methyl-2H-furan-5-one (PubChem CID 101413883) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-(3-hydroxy-3-methylpent-4-enyl)-3-methyl-2H-furan-5-one.
| Compound Name | 2-(3-hydroxy-3-methylpent-4-enyl)-3-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 101413883 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2-(3-hydroxy-3-methylpent-4-enyl)-3-methyl-2H-furan-5-one |
| SMILES | C=CC(C)(O)CCC1OC(=O)C=C1C |
| InChI | InChI=1S/C11H16O3/c1-4-11(3,13)6-5-9-8(2)7-10(12)14-9/h4,7,9,13H,1,5-6H2,2-3H3 |
| InChIKey | QQUVUDPCFCXEGO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|