C20H30O3 — CID 14633116
(3E)-5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3-(4-hydroxy-4-methylhex-5-enylidene)oxolan-2-one (PubChem CID 14633116) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (3E)-5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3-(4-hydroxy-4-methylhex-5-enylidene)oxolan-2-one.
| Compound Name | (3E)-5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3-(4-hydroxy-4-methylhex-5-enylidene)oxolan-2-one |
|---|---|
| PubChem CID | 14633116 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (3E)-5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3-(4-hydroxy-4-methylhex-5-enylidene)oxolan-2-one |
| SMILES | C=CC(C)(O)CC/C=C1\CC(/C=C(\C)CCC=C(C)C)OC1=O |
| InChI | InChI=1S/C20H30O3/c1-6-20(5,22)12-8-11-17-14-18(23-19(17)21)13-16(4)10-7-9-15(2)3/h6,9,11,13,18,22H,1,7-8,10,12,14H2,2-5H3/b16-13+,17-11+ |
| InChIKey | AYKMUWWDCKYTDG-RLDGMBHXSA-N |
| XLogP | 4.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|