About [(2R)-1-hydroxy-3-methyl-5-phenylpenta-3,4-dien-2-yl] acetate
[(2R)-1-hydroxy-3-methyl-5-phenylpenta-3,4-dien-2-yl] acetate (PubChem CID 101414734) has the molecular formula C14H16O3
and a molecular weight of 232.28 g/mol. Its IUPAC name is [(2R)-1-hydroxy-3-methyl-5-phenylpenta-3,4-dien-2-yl] acetate.
Analyze [(2R)-1-hydroxy-3-methyl-5-phenylpenta-3,4-dien-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-hydroxy-3-methyl-5-phenylpenta-3,4-dien-2-yl] acetate?
The IUPAC name of [(2R)-1-hydroxy-3-methyl-5-phenylpenta-3,4-dien-2-yl] acetate (CID 101414734) is [(2R)-1-hydroxy-3-methyl-5-phenylpenta-3,4-dien-2-yl] acetate.
What is the SMILES notation for [(2R)-1-hydroxy-3-methyl-5-phenylpenta-3,4-dien-2-yl] acetate?
The canonical SMILES for [(2R)-1-hydroxy-3-methyl-5-phenylpenta-3,4-dien-2-yl] acetate is CC(=O)O[C@@H](CO)C(C)=C=Cc1ccccc1.
What is the InChIKey of [(2R)-1-hydroxy-3-methyl-5-phenylpenta-3,4-dien-2-yl] acetate?
The InChIKey is CRCRJMLZWOQMPB-OMXDBJJSSA-N. The full InChI is InChI=1S/C14H16O3/c1-11(14(10-15)17-12(2)16)8-9-13-6-4-3-5-7-13/h3-7,9,14-15H,10H2,1-2H3/t8?,14-/m0/s1.
What are the key properties of [(2R)-1-hydroxy-3-methyl-5-phenylpenta-3,4-dien-2-yl] acetate?
[(2R)-1-hydroxy-3-methyl-5-phenylpenta-3,4-dien-2-yl] acetate has a molecular weight of 232.28 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-hydroxy-3-methyl-5-phenylpenta-3,4-dien-2-yl] acetate is sourced from PubChem (CID 101414734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).