C17H24O8 — CID 175086984
2-methylprop-2-enoic acid;pentane-1,2,3,4,5-pentol;2-phenylethenone (PubChem CID 175086984) has the molecular formula C17H24O8 and a molecular weight of 356.37 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;pentane-1,2,3,4,5-pentol;2-phenylethenone.
| Compound Name | 2-methylprop-2-enoic acid;pentane-1,2,3,4,5-pentol;2-phenylethenone |
|---|---|
| PubChem CID | 175086984 |
| Molecular Formula | C17H24O8 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-methylprop-2-enoic acid;pentane-1,2,3,4,5-pentol;2-phenylethenone |
| SMILES | C=C(C)C(=O)O.O=C=Cc1ccccc1.OCC(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H6O.C5H12O5.C4H6O2/c9-7-6-8-4-2-1-3-5-8;6-1-3(8)5(10)4(9)2-7;1-3(2)4(5)6/h1-6H;3-10H,1-2H2;1H2,2H3,(H,5,6) |
| InChIKey | VWWCRVGCWITJMJ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|