C20H16N2O2S4 — CID 101414769
N-[4-[[2,3-bis(sulfanyl)benzoyl]amino]phenyl]-2,3-bis(sulfanyl)benzamide (PubChem CID 101414769) has the molecular formula C20H16N2O2S4 and a molecular weight of 444.63 g/mol. Its IUPAC name is N-[4-[[2,3-bis(sulfanyl)benzoyl]amino]phenyl]-2,3-bis(sulfanyl)benzamide.
| Compound Name | N-[4-[[2,3-bis(sulfanyl)benzoyl]amino]phenyl]-2,3-bis(sulfanyl)benzamide |
|---|---|
| PubChem CID | 101414769 |
| Molecular Formula | C20H16N2O2S4 |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | N-[4-[[2,3-bis(sulfanyl)benzoyl]amino]phenyl]-2,3-bis(sulfanyl)benzamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2cccc(S)c2S)cc1)c1cccc(S)c1S |
| InChI | InChI=1S/C20H16N2O2S4/c23-19(13-3-1-5-15(25)17(13)27)21-11-7-9-12(10-8-11)22-20(24)14-4-2-6-16(26)18(14)28/h1-10,25-28H,(H,21,23)(H,22,24) |
| InChIKey | GSHIJWOBYJSJPH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|