C23H24N2O2 — CID 101416867
(2R)-N-benzyl-2-(3,4-dimethylphenyl)-2-(2-hydroxyanilino)acetamide (PubChem CID 101416867) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is (2R)-N-benzyl-2-(3,4-dimethylphenyl)-2-(2-hydroxyanilino)acetamide.
| Compound Name | (2R)-N-benzyl-2-(3,4-dimethylphenyl)-2-(2-hydroxyanilino)acetamide |
|---|---|
| PubChem CID | 101416867 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (2R)-N-benzyl-2-(3,4-dimethylphenyl)-2-(2-hydroxyanilino)acetamide |
| SMILES | Cc1ccc([C@@H](Nc2ccccc2O)C(=O)NCc2ccccc2)cc1C |
| InChI | InChI=1S/C23H24N2O2/c1-16-12-13-19(14-17(16)2)22(25-20-10-6-7-11-21(20)26)23(27)24-15-18-8-4-3-5-9-18/h3-14,22,25-26H,15H2,1-2H3,(H,24,27)/t22-/m1/s1 |
| InChIKey | WJQUUQNBJORBAA-JOCHJYFZSA-N |
| XLogP | 4.48 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|