C13H24O6Si — CID 101417173
dimethyl (2R,6S)-5-trimethylsilyloxyoxepane-2,6-dicarboxylate (PubChem CID 101417173) has the molecular formula C13H24O6Si and a molecular weight of 304.42 g/mol. Its IUPAC name is dimethyl (2R,6S)-5-trimethylsilyloxyoxepane-2,6-dicarboxylate.
| Compound Name | dimethyl (2R,6S)-5-trimethylsilyloxyoxepane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 101417173 |
| Molecular Formula | C13H24O6Si |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | dimethyl (2R,6S)-5-trimethylsilyloxyoxepane-2,6-dicarboxylate |
| SMILES | COC(=O)[C@H]1CO[C@@H](C(=O)OC)CCC1O[Si](C)(C)C |
| InChI | InChI=1S/C13H24O6Si/c1-16-12(14)9-8-18-11(13(15)17-2)7-6-10(9)19-20(3,4)5/h9-11H,6-8H2,1-5H3/t9-,10?,11+/m0/s1 |
| InChIKey | ABLDNBBDGRBKKF-KHUXNXPUSA-N |
| XLogP | 1.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|