C15H28O5Si — CID 10936005
[(4R,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-7-methyl-2-oxooxepan-4-yl] acetate (PubChem CID 10936005) has the molecular formula C15H28O5Si and a molecular weight of 316.47 g/mol. Its IUPAC name is [(4R,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-7-methyl-2-oxooxepan-4-yl] acetate.
| Compound Name | [(4R,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-7-methyl-2-oxooxepan-4-yl] acetate |
|---|---|
| PubChem CID | 10936005 |
| Molecular Formula | C15H28O5Si |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | [(4R,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-7-methyl-2-oxooxepan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC(=O)O[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C15H28O5Si/c1-10-13(20-21(6,7)15(3,4)5)8-12(19-11(2)16)9-14(17)18-10/h10,12-13H,8-9H2,1-7H3/t10-,12-,13-/m1/s1 |
| InChIKey | PXUAUGFJKSXNSJ-RAIGVLPGSA-N |
| XLogP | 3.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|