C26H58O5Si3 — CID 11124340
methyl (3S,5R,6R)-3,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]heptanoate (PubChem CID 11124340) has the molecular formula C26H58O5Si3 and a molecular weight of 535.00 g/mol. Its IUPAC name is methyl (3S,5R,6R)-3,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]heptanoate.
| Compound Name | methyl (3S,5R,6R)-3,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]heptanoate |
|---|---|
| PubChem CID | 11124340 |
| Molecular Formula | C26H58O5Si3 |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.36 |
| IUPAC Name | methyl (3S,5R,6R)-3,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]heptanoate |
| SMILES | COC(=O)C[C@H](C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H58O5Si3/c1-20(29-32(12,13)24(2,3)4)22(31-34(16,17)26(8,9)10)18-21(19-23(27)28-11)30-33(14,15)25(5,6)7/h20-22H,18-19H2,1-17H3/t20-,21+,22-/m1/s1 |
| InChIKey | LWESNPGYMOZHED-BHIFYINESA-N |
| XLogP | 8.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|