C15H29IO4Si — CID 11487175
ethyl 2-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(iodomethyl)oxolan-2-yl]acetate (PubChem CID 11487175) has the molecular formula C15H29IO4Si and a molecular weight of 428.38 g/mol. Its IUPAC name is ethyl 2-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(iodomethyl)oxolan-2-yl]acetate.
| Compound Name | ethyl 2-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(iodomethyl)oxolan-2-yl]acetate |
|---|---|
| PubChem CID | 11487175 |
| Molecular Formula | C15H29IO4Si |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | ethyl 2-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(iodomethyl)oxolan-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CI)O1 |
| InChI | InChI=1S/C15H29IO4Si/c1-7-18-14(17)9-11-8-12(13(10-16)19-11)20-21(5,6)15(2,3)4/h11-13H,7-10H2,1-6H3/t11-,12+,13-/m1/s1 |
| InChIKey | GAFBPHUFYPSTGE-FRRDWIJNSA-N |
| XLogP | 3.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|