C12H14O2S — CID 101417706
methyl (2E,4Z,8E)-5-methylsulfanyldeca-2,4,8-trien-6-ynoate (PubChem CID 101417706) has the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is methyl (2E,4Z,8E)-5-methylsulfanyldeca-2,4,8-trien-6-ynoate.
| Compound Name | methyl (2E,4Z,8E)-5-methylsulfanyldeca-2,4,8-trien-6-ynoate |
|---|---|
| PubChem CID | 101417706 |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | methyl (2E,4Z,8E)-5-methylsulfanyldeca-2,4,8-trien-6-ynoate |
| SMILES | C/C=C/C#C/C(=C/C=C/C(=O)OC)SC |
| InChI | InChI=1S/C12H14O2S/c1-4-5-6-8-11(15-3)9-7-10-12(13)14-2/h4-5,7,9-10H,1-3H3/b5-4+,10-7+,11-9- |
| InChIKey | AJETYWZVYZWNNH-JADDBGHTSA-N |
| XLogP | 2.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|