C12H12O6 — CID 11425258
trimethyl (3E,5E)-hexa-3,5-dien-1-yne-1,3,6-tricarboxylate (PubChem CID 11425258) has the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. Its IUPAC name is trimethyl (3E,5E)-hexa-3,5-dien-1-yne-1,3,6-tricarboxylate.
| Compound Name | trimethyl (3E,5E)-hexa-3,5-dien-1-yne-1,3,6-tricarboxylate |
|---|---|
| PubChem CID | 11425258 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | trimethyl (3E,5E)-hexa-3,5-dien-1-yne-1,3,6-tricarboxylate |
| SMILES | COC(=O)C#C/C(=C\C=C\C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C12H12O6/c1-16-10(13)6-4-5-9(12(15)18-3)7-8-11(14)17-2/h4-6H,1-3H3/b6-4+,9-5+ |
| InChIKey | CPXMUEZMQJPIIT-REZHQCRGSA-N |
| XLogP | -0.01 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|