C20H22O3 — CID 101418237
4-(4-methoxyphenyl)-8-methyl-5-propan-2-yl-3,4-dihydrochromen-2-one (PubChem CID 101418237) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-8-methyl-5-propan-2-yl-3,4-dihydrochromen-2-one.
| Compound Name | 4-(4-methoxyphenyl)-8-methyl-5-propan-2-yl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 101418237 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 4-(4-methoxyphenyl)-8-methyl-5-propan-2-yl-3,4-dihydrochromen-2-one |
| SMILES | COc1ccc(C2CC(=O)Oc3c(C)ccc(C(C)C)c32)cc1 |
| InChI | InChI=1S/C20H22O3/c1-12(2)16-10-5-13(3)20-19(16)17(11-18(21)23-20)14-6-8-15(22-4)9-7-14/h5-10,12,17H,11H2,1-4H3 |
| InChIKey | FBQZJCODSCQOGF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|