C27H33NO7 — CID 101419366
(3R,4R)-4,5-dihydroxy-6-[(E)-2-[(2R,5R)-5-hydroxy-2,6,6-trimethyloxan-2-yl]ethenyl]-3-methoxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one (PubChem CID 101419366) has the molecular formula C27H33NO7 and a molecular weight of 483.56 g/mol. Its IUPAC name is (3R,4R)-4,5-dihydroxy-6-[(E)-2-[(2R,5R)-5-hydroxy-2,6,6-trimethyloxan-2-yl]ethenyl]-3-methoxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one.
| Compound Name | (3R,4R)-4,5-dihydroxy-6-[(E)-2-[(2R,5R)-5-hydroxy-2,6,6-trimethyloxan-2-yl]ethenyl]-3-methoxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 101419366 |
| Molecular Formula | C27H33NO7 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | (3R,4R)-4,5-dihydroxy-6-[(E)-2-[(2R,5R)-5-hydroxy-2,6,6-trimethyloxan-2-yl]ethenyl]-3-methoxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one |
| SMILES | COc1ccc([C@@]2(O)c3c(ccc(/C=C/[C@@]4(C)CC[C@@H](O)C(C)(C)O4)c3O)NC(=O)[C@@H]2OC)cc1 |
| InChI | InChI=1S/C27H33NO7/c1-25(2)20(29)13-15-26(3,35-25)14-12-16-6-11-19-21(22(16)30)27(32,23(34-5)24(31)28-19)17-7-9-18(33-4)10-8-17/h6-12,14,20,23,29-30,32H,13,15H2,1-5H3,(H,28,31)/b14-12+/t20-,23+,26+,27-/m1/s1 |
| InChIKey | UTNVYRJWGOKFBF-MXZNYFIPSA-N |
| XLogP | 3.33 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |