C27H31NO6 — CID 123131767
(3R,4R)-6-[(1E,3E)-3,7-dimethyl-6-oxoocta-1,3-dienyl]-4,5-dihydroxy-3-methoxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one (PubChem CID 123131767) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is (3R,4R)-6-[(1E,3E)-3,7-dimethyl-6-oxoocta-1,3-dienyl]-4,5-dihydroxy-3-methoxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one.
| Compound Name | (3R,4R)-6-[(1E,3E)-3,7-dimethyl-6-oxoocta-1,3-dienyl]-4,5-dihydroxy-3-methoxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 123131767 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | (3R,4R)-6-[(1E,3E)-3,7-dimethyl-6-oxoocta-1,3-dienyl]-4,5-dihydroxy-3-methoxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one |
| SMILES | COc1ccc([C@@]2(O)c3c(ccc(/C=C/C(C)=C/CC(=O)C(C)C)c3O)NC(=O)[C@@H]2OC)cc1 |
| InChI | InChI=1S/C27H31NO6/c1-16(2)22(29)15-7-17(3)6-8-18-9-14-21-23(24(18)30)27(32,25(34-5)26(31)28-21)19-10-12-20(33-4)13-11-19/h6-14,16,25,30,32H,15H2,1-5H3,(H,28,31)/b8-6+,17-7+/t25-,27+/m0/s1 |
| InChIKey | HYNOJYOORWTNHW-LNVCDVGFSA-N |
| XLogP | 4.18 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|