C23H25NO4S — CID 146306302
6-[2-(2-ethoxyprop-2-enylsulfanyl)ethenyl]-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one (PubChem CID 146306302) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is 6-[2-(2-ethoxyprop-2-enylsulfanyl)ethenyl]-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one.
| Compound Name | 6-[2-(2-ethoxyprop-2-enylsulfanyl)ethenyl]-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 146306302 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 6-[2-(2-ethoxyprop-2-enylsulfanyl)ethenyl]-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one |
| SMILES | C=C(CSC=Cc1ccc2c(c1)C(O)(c1ccccc1)C(OC)C(=O)N2)OCC |
| InChI | InChI=1S/C23H25NO4S/c1-4-28-16(2)15-29-13-12-17-10-11-20-19(14-17)23(26,18-8-6-5-7-9-18)21(27-3)22(25)24-20/h5-14,21,26H,2,4,15H2,1,3H3,(H,24,25) |
| InChIKey | KVMUZCXIYOMTFP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|