C24H27NO4 — CID 146306209
6-[(1E)-5-ethoxyhexa-1,5-dienyl]-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one (PubChem CID 146306209) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 6-[(1E)-5-ethoxyhexa-1,5-dienyl]-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one.
| Compound Name | 6-[(1E)-5-ethoxyhexa-1,5-dienyl]-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 146306209 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 6-[(1E)-5-ethoxyhexa-1,5-dienyl]-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one |
| SMILES | C=C(CC/C=C/c1ccc2c(c1)C(O)(c1ccccc1)C(OC)C(=O)N2)OCC |
| InChI | InChI=1S/C24H27NO4/c1-4-29-17(2)10-8-9-11-18-14-15-21-20(16-18)24(27,19-12-6-5-7-13-19)22(28-3)23(26)25-21/h5-7,9,11-16,22,27H,2,4,8,10H2,1,3H3,(H,25,26)/b11-9+ |
| InChIKey | OAXATSJFJNOLMH-PKNBQFBNSA-N |
| XLogP | 4.23 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|