C16H21F2N — CID 101419531
N-cyclohexyl-2,2-difluoro-1-phenylbutan-1-imine (PubChem CID 101419531) has the molecular formula C16H21F2N and a molecular weight of 265.35 g/mol. Its IUPAC name is N-cyclohexyl-2,2-difluoro-1-phenylbutan-1-imine.
| Compound Name | N-cyclohexyl-2,2-difluoro-1-phenylbutan-1-imine |
|---|---|
| PubChem CID | 101419531 |
| Molecular Formula | C16H21F2N |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | N-cyclohexyl-2,2-difluoro-1-phenylbutan-1-imine |
| SMILES | CCC(F)(F)/C(=N\C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C16H21F2N/c1-2-16(17,18)15(13-9-5-3-6-10-13)19-14-11-7-4-8-12-14/h3,5-6,9-10,14H,2,4,7-8,11-12H2,1H3/b19-15- |
| InChIKey | KNUVCYGCEDSPJJ-CYVLTUHYSA-N |
| XLogP | 4.85 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|