C21H26INO2 — CID 101420300
(3S,4R)-4-(iodomethyl)-3-methyl-3-(2-methylpropyl)-1-(naphthalen-2-ylmethoxy)pyrrolidin-2-one (PubChem CID 101420300) has the molecular formula C21H26INO2 and a molecular weight of 451.35 g/mol. Its IUPAC name is (3S,4R)-4-(iodomethyl)-3-methyl-3-(2-methylpropyl)-1-(naphthalen-2-ylmethoxy)pyrrolidin-2-one.
| Compound Name | (3S,4R)-4-(iodomethyl)-3-methyl-3-(2-methylpropyl)-1-(naphthalen-2-ylmethoxy)pyrrolidin-2-one |
|---|---|
| PubChem CID | 101420300 |
| Molecular Formula | C21H26INO2 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | (3S,4R)-4-(iodomethyl)-3-methyl-3-(2-methylpropyl)-1-(naphthalen-2-ylmethoxy)pyrrolidin-2-one |
| SMILES | CC(C)C[C@]1(C)C(=O)N(OCc2ccc3ccccc3c2)C[C@@H]1CI |
| InChI | InChI=1S/C21H26INO2/c1-15(2)11-21(3)19(12-22)13-23(20(21)24)25-14-16-8-9-17-6-4-5-7-18(17)10-16/h4-10,15,19H,11-14H2,1-3H3/t19-,21-/m0/s1 |
| InChIKey | IFBZXMFOTXIMLM-FPOVZHCZSA-N |
| XLogP | 5.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|