C18H19F7INO2 — CID 71506536
(3R,4S)-4-(1-iodoethyl)-3-methyl-1-phenylmethoxy-3-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]pyrrolidin-2-one (PubChem CID 71506536) has the molecular formula C18H19F7INO2 and a molecular weight of 541.25 g/mol. Its IUPAC name is (3R,4S)-4-(1-iodoethyl)-3-methyl-1-phenylmethoxy-3-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]pyrrolidin-2-one.
| Compound Name | (3R,4S)-4-(1-iodoethyl)-3-methyl-1-phenylmethoxy-3-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 71506536 |
| Molecular Formula | C18H19F7INO2 |
| Molecular Weight | 541.25 g/mol |
| Exact Mass | 541.03 |
| IUPAC Name | (3R,4S)-4-(1-iodoethyl)-3-methyl-1-phenylmethoxy-3-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]pyrrolidin-2-one |
| SMILES | CC(I)[C@@H]1CN(OCc2ccccc2)C(=O)[C@]1(C)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H19F7INO2/c1-11(26)13-8-27(29-9-12-6-4-3-5-7-12)14(28)15(13,2)10-16(19,17(20,21)22)18(23,24)25/h3-7,11,13H,8-10H2,1-2H3/t11?,13-,15+/m0/s1 |
| InChIKey | HLPPJWDUKJOPAQ-RDNFXGMISA-N |
| XLogP | 5.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.25 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|