C18H15F9INO2 — CID 102344859
(3S,4Z)-3-[2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butyl]-4-(iodomethylidene)-3-methyl-1-phenylmethoxypyrrolidin-2-one (PubChem CID 102344859) has the molecular formula C18H15F9INO2 and a molecular weight of 575.21 g/mol. Its IUPAC name is (3S,4Z)-3-[2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butyl]-4-(iodomethylidene)-3-methyl-1-phenylmethoxypyrrolidin-2-one.
| Compound Name | (3S,4Z)-3-[2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butyl]-4-(iodomethylidene)-3-methyl-1-phenylmethoxypyrrolidin-2-one |
|---|---|
| PubChem CID | 102344859 |
| Molecular Formula | C18H15F9INO2 |
| Molecular Weight | 575.21 g/mol |
| Exact Mass | 575.00 |
| IUPAC Name | (3S,4Z)-3-[2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butyl]-4-(iodomethylidene)-3-methyl-1-phenylmethoxypyrrolidin-2-one |
| SMILES | C[C@@]1(CC(F)(C(F)(F)F)C(F)(F)C(F)(F)F)C(=O)N(OCc2ccccc2)C/C1=C\I |
| InChI | InChI=1S/C18H15F9INO2/c1-14(10-15(19,17(22,23)24)16(20,21)18(25,26)27)12(7-28)8-29(13(14)30)31-9-11-5-3-2-4-6-11/h2-7H,8-10H2,1H3/b12-7+/t14-,15?/m0/s1 |
| InChIKey | LVXBYXATNDNORA-XCOWQIESSA-N |
| XLogP | 6.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.21 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|