C18H24INO4 — CID 71506539
ethyl 3-[(3S,4R)-4-(iodomethyl)-3-methyl-2-oxo-1-phenylmethoxypyrrolidin-3-yl]propanoate (PubChem CID 71506539) has the molecular formula C18H24INO4 and a molecular weight of 445.30 g/mol. Its IUPAC name is ethyl 3-[(3S,4R)-4-(iodomethyl)-3-methyl-2-oxo-1-phenylmethoxypyrrolidin-3-yl]propanoate.
| Compound Name | ethyl 3-[(3S,4R)-4-(iodomethyl)-3-methyl-2-oxo-1-phenylmethoxypyrrolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 71506539 |
| Molecular Formula | C18H24INO4 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | ethyl 3-[(3S,4R)-4-(iodomethyl)-3-methyl-2-oxo-1-phenylmethoxypyrrolidin-3-yl]propanoate |
| SMILES | CCOC(=O)CC[C@]1(C)C(=O)N(OCc2ccccc2)C[C@@H]1CI |
| InChI | InChI=1S/C18H24INO4/c1-3-23-16(21)9-10-18(2)15(11-19)12-20(17(18)22)24-13-14-7-5-4-6-8-14/h4-8,15H,3,9-13H2,1-2H3/t15-,18-/m0/s1 |
| InChIKey | LFTNCEWFYGWFCC-YJBOKZPZSA-N |
| XLogP | 3.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|