C18H17F9INO2 — CID 71503968
(3S,4R)-3-(iodomethyl)-3-methyl-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)-1-phenylmethoxypyrrolidin-2-one (PubChem CID 71503968) has the molecular formula C18H17F9INO2 and a molecular weight of 577.23 g/mol. Its IUPAC name is (3S,4R)-3-(iodomethyl)-3-methyl-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)-1-phenylmethoxypyrrolidin-2-one.
| Compound Name | (3S,4R)-3-(iodomethyl)-3-methyl-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)-1-phenylmethoxypyrrolidin-2-one |
|---|---|
| PubChem CID | 71503968 |
| Molecular Formula | C18H17F9INO2 |
| Molecular Weight | 577.23 g/mol |
| Exact Mass | 577.02 |
| IUPAC Name | (3S,4R)-3-(iodomethyl)-3-methyl-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)-1-phenylmethoxypyrrolidin-2-one |
| SMILES | C[C@@]1(CI)C(=O)N(OCc2ccccc2)C[C@@H]1CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H17F9INO2/c1-14(10-28)12(7-15(19,20)16(21,22)17(23,24)18(25,26)27)8-29(13(14)30)31-9-11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3/t12-,14-/m0/s1 |
| InChIKey | SCGGLZPFAKOBSV-JSGCOSHPSA-N |
| XLogP | 5.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.23 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|