C26H34N2O3 — CID 23631414
(3S,4R)-3-(cyclohexylmethyl)-3-methyl-1-phenylmethoxy-4-(phenylmethoxyamino)pyrrolidin-2-one (PubChem CID 23631414) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is (3S,4R)-3-(cyclohexylmethyl)-3-methyl-1-phenylmethoxy-4-(phenylmethoxyamino)pyrrolidin-2-one.
| Compound Name | (3S,4R)-3-(cyclohexylmethyl)-3-methyl-1-phenylmethoxy-4-(phenylmethoxyamino)pyrrolidin-2-one |
|---|---|
| PubChem CID | 23631414 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | (3S,4R)-3-(cyclohexylmethyl)-3-methyl-1-phenylmethoxy-4-(phenylmethoxyamino)pyrrolidin-2-one |
| SMILES | C[C@@]1(CC2CCCCC2)C(=O)N(OCc2ccccc2)C[C@@H]1NOCc1ccccc1 |
| InChI | InChI=1S/C26H34N2O3/c1-26(17-21-11-5-2-6-12-21)24(27-30-19-22-13-7-3-8-14-22)18-28(25(26)29)31-20-23-15-9-4-10-16-23/h3-4,7-10,13-16,21,24,27H,2,5-6,11-12,17-20H2,1H3/t24-,26-/m0/s1 |
| InChIKey | BYMLGPQFJHFUAZ-AHWVRZQESA-N |
| XLogP | 5.03 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|