C16H19NO3 — CID 71535762
(1R,5S)-1'-phenylmethoxyspiro[6-oxabicyclo[3.1.0]hexane-3,3'-piperidine]-2'-one (PubChem CID 71535762) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is (1R,5S)-1'-phenylmethoxyspiro[6-oxabicyclo[3.1.0]hexane-3,3'-piperidine]-2'-one.
| Compound Name | (1R,5S)-1'-phenylmethoxyspiro[6-oxabicyclo[3.1.0]hexane-3,3'-piperidine]-2'-one |
|---|---|
| PubChem CID | 71535762 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (1R,5S)-1'-phenylmethoxyspiro[6-oxabicyclo[3.1.0]hexane-3,3'-piperidine]-2'-one |
| SMILES | O=C1N(OCc2ccccc2)CCCC12C[C@@H]1O[C@@H]1C2 |
| InChI | InChI=1S/C16H19NO3/c18-15-16(9-13-14(10-16)20-13)7-4-8-17(15)19-11-12-5-2-1-3-6-12/h1-3,5-6,13-14H,4,7-11H2/t13-,14+,16? |
| InChIKey | CFFVQBIZIPWRAH-MZBDJJRSSA-N |
| XLogP | 2.29 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|