C24H22NO3P — CID 101421164
[2-[(4R,5S)-5-(4,5-dihydro-1,3-oxazol-2-yl)-1,3-dioxolan-4-yl]phenyl]-diphenylphosphane (PubChem CID 101421164) has the molecular formula C24H22NO3P and a molecular weight of 403.42 g/mol. Its IUPAC name is [2-[(4R,5S)-5-(4,5-dihydro-1,3-oxazol-2-yl)-1,3-dioxolan-4-yl]phenyl]-diphenylphosphane.
| Compound Name | [2-[(4R,5S)-5-(4,5-dihydro-1,3-oxazol-2-yl)-1,3-dioxolan-4-yl]phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 101421164 |
| Molecular Formula | C24H22NO3P |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | [2-[(4R,5S)-5-(4,5-dihydro-1,3-oxazol-2-yl)-1,3-dioxolan-4-yl]phenyl]-diphenylphosphane |
| SMILES | c1ccc(P(c2ccccc2)c2ccccc2[C@H]2OCO[C@@H]2C2=NCCO2)cc1 |
| InChI | InChI=1S/C24H22NO3P/c1-3-9-18(10-4-1)29(19-11-5-2-6-12-19)21-14-8-7-13-20(21)22-23(28-17-27-22)24-25-15-16-26-24/h1-14,22-23H,15-17H2/t22-,23+/m1/s1 |
| InChIKey | KFRMEPZDBFJGOP-PKTZIBPZSA-N |
| XLogP | 3.29 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|