About 2-methyl-11-phenoxytetracene-5,12-dione
2-methyl-11-phenoxytetracene-5,12-dione (PubChem CID 101421338) has the molecular formula C25H16O3
and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-methyl-11-phenoxytetracene-5,12-dione.
Molecular Properties
| Compound Name | 2-methyl-11-phenoxytetracene-5,12-dione |
| PubChem CID | 101421338 |
| Molecular Formula | C25H16O3 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-methyl-11-phenoxytetracene-5,12-dione |
| SMILES | Cc1ccc2c(c1)C(=O)c1c(cc3ccccc3c1Oc1ccccc1)C2=O |
| InChI | InChI=1S/C25H16O3/c1-15-11-12-19-20(13-15)24(27)22-21(23(19)26)14-16-7-5-6-10-18(16)25(22)28-17-8-3-2-4-9-17/h2-14H,1H3 |
| InChIKey | CNTRRVKEQKJNSZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-11-phenoxytetracene-5,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-11-phenoxytetracene-5,12-dione?
The IUPAC name of 2-methyl-11-phenoxytetracene-5,12-dione (CID 101421338) is 2-methyl-11-phenoxytetracene-5,12-dione.
What is the SMILES notation for 2-methyl-11-phenoxytetracene-5,12-dione?
The canonical SMILES for 2-methyl-11-phenoxytetracene-5,12-dione is Cc1ccc2c(c1)C(=O)c1c(cc3ccccc3c1Oc1ccccc1)C2=O.
What is the InChIKey of 2-methyl-11-phenoxytetracene-5,12-dione?
The InChIKey is CNTRRVKEQKJNSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H16O3/c1-15-11-12-19-20(13-15)24(27)22-21(23(19)26)14-16-7-5-6-10-18(16)25(22)28-17-8-3-2-4-9-17/h2-14H,1H3.
What are the key properties of 2-methyl-11-phenoxytetracene-5,12-dione?
2-methyl-11-phenoxytetracene-5,12-dione has a molecular weight of 364.40 g/mol, XLogP of 5.72, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-11-phenoxytetracene-5,12-dione is sourced from PubChem (CID 101421338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).