C26H20O2 — CID 141286138
1,2,3,4-tetramethylpentacene-6,13-dione (PubChem CID 141286138) has the molecular formula C26H20O2 and a molecular weight of 364.44 g/mol. Its IUPAC name is 1,2,3,4-tetramethylpentacene-6,13-dione.
| Compound Name | 1,2,3,4-tetramethylpentacene-6,13-dione |
|---|---|
| PubChem CID | 141286138 |
| Molecular Formula | C26H20O2 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1,2,3,4-tetramethylpentacene-6,13-dione |
| SMILES | Cc1c(C)c(C)c2cc3c(cc2c1C)C(=O)c1cc2ccccc2cc1C3=O |
| InChI | InChI=1S/C26H20O2/c1-13-14(2)16(4)20-12-24-23(11-19(20)15(13)3)25(27)21-9-17-7-5-6-8-18(17)10-22(21)26(24)28/h5-12H,1-4H3 |
| InChIKey | JORSIXXIELETRR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|