C18H26 — CID 101421845
1-(1-cyclopenta-1,3-dien-1-ylcyclohexyl)cycloheptene (PubChem CID 101421845) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 1-(1-cyclopenta-1,3-dien-1-ylcyclohexyl)cycloheptene.
| Compound Name | 1-(1-cyclopenta-1,3-dien-1-ylcyclohexyl)cycloheptene |
|---|---|
| PubChem CID | 101421845 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-(1-cyclopenta-1,3-dien-1-ylcyclohexyl)cycloheptene |
| SMILES | C1=CCC(C2(C3=CCCCCC3)CCCCC2)=C1 |
| InChI | InChI=1S/C18H26/c1-2-5-11-16(10-4-1)18(14-8-3-9-15-18)17-12-6-7-13-17/h6-7,10,12H,1-5,8-9,11,13-15H2 |
| InChIKey | HHRWWCPJLYZRHW-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|