C13H19N — CID 163961063
6-(cyclopenten-1-yl)-6-methylcyclohepta-1,3-dien-1-amine (PubChem CID 163961063) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 6-(cyclopenten-1-yl)-6-methylcyclohepta-1,3-dien-1-amine.
| Compound Name | 6-(cyclopenten-1-yl)-6-methylcyclohepta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 163961063 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 6-(cyclopenten-1-yl)-6-methylcyclohepta-1,3-dien-1-amine |
| SMILES | CC1(C2=CCCC2)CC=CC=C(N)C1 |
| InChI | InChI=1S/C13H19N/c1-13(11-6-2-3-7-11)9-5-4-8-12(14)10-13/h4-6,8H,2-3,7,9-10,14H2,1H3 |
| InChIKey | SHMNPQFQTVAHFD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|