C12H14O4 — CID 101423179
ethyl (2R,3S)-3-[(S)-hydroxy(phenyl)methyl]oxirane-2-carboxylate (PubChem CID 101423179) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is ethyl (2R,3S)-3-[(S)-hydroxy(phenyl)methyl]oxirane-2-carboxylate.
| Compound Name | ethyl (2R,3S)-3-[(S)-hydroxy(phenyl)methyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 101423179 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | ethyl (2R,3S)-3-[(S)-hydroxy(phenyl)methyl]oxirane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1O[C@H]1[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C12H14O4/c1-2-15-12(14)11-10(16-11)9(13)8-6-4-3-5-7-8/h3-7,9-11,13H,2H2,1H3/t9-,10-,11+/m0/s1 |
| InChIKey | PQRPZRUAHBBNEU-GARJFASQSA-N |
| XLogP | 1.05 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|