C19H23NO2 — CID 101425755
(3S,4S)-3-cyclohexyl-1-phenyl-4-prop-2-enylpyrrolidine-2,5-dione (PubChem CID 101425755) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (3S,4S)-3-cyclohexyl-1-phenyl-4-prop-2-enylpyrrolidine-2,5-dione.
| Compound Name | (3S,4S)-3-cyclohexyl-1-phenyl-4-prop-2-enylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 101425755 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (3S,4S)-3-cyclohexyl-1-phenyl-4-prop-2-enylpyrrolidine-2,5-dione |
| SMILES | C=CC[C@@H]1C(=O)N(c2ccccc2)C(=O)[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C19H23NO2/c1-2-9-16-17(14-10-5-3-6-11-14)19(22)20(18(16)21)15-12-7-4-8-13-15/h2,4,7-8,12-14,16-17H,1,3,5-6,9-11H2/t16-,17-/m0/s1 |
| InChIKey | RJSQZZVMYKZUDY-IRXDYDNUSA-N |
| XLogP | 3.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|