C19H15N3 — CID 101425986
4-(4-imidazo[1,5-a]pyridin-3-ylphenyl)aniline (PubChem CID 101425986) has the molecular formula C19H15N3 and a molecular weight of 285.35 g/mol. Its IUPAC name is 4-(4-imidazo[1,5-a]pyridin-3-ylphenyl)aniline.
| Compound Name | 4-(4-imidazo[1,5-a]pyridin-3-ylphenyl)aniline |
|---|---|
| PubChem CID | 101425986 |
| Molecular Formula | C19H15N3 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 4-(4-imidazo[1,5-a]pyridin-3-ylphenyl)aniline |
| SMILES | Nc1ccc(-c2ccc(-c3ncc4ccccn34)cc2)cc1 |
| InChI | InChI=1S/C19H15N3/c20-17-10-8-15(9-11-17)14-4-6-16(7-5-14)19-21-13-18-3-1-2-12-22(18)19/h1-13H,20H2 |
| InChIKey | JSRGDGZIWGBVDL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|