C20H13F3N2 — CID 122379881
3-[2-phenyl-5-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridine (PubChem CID 122379881) has the molecular formula C20H13F3N2 and a molecular weight of 338.33 g/mol. Its IUPAC name is 3-[2-phenyl-5-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridine.
| Compound Name | 3-[2-phenyl-5-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 122379881 |
| Molecular Formula | C20H13F3N2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 3-[2-phenyl-5-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridine |
| SMILES | FC(F)(F)c1ccc(-c2ccccc2)c(-c2ncc3ccccn23)c1 |
| InChI | InChI=1S/C20H13F3N2/c21-20(22,23)15-9-10-17(14-6-2-1-3-7-14)18(12-15)19-24-13-16-8-4-5-11-25(16)19/h1-13H |
| InChIKey | RHCOEAYYQLQEQR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |