C13H10BrN3 — CID 117158440
4-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline (PubChem CID 117158440) has the molecular formula C13H10BrN3 and a molecular weight of 288.15 g/mol. Its IUPAC name is 4-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline.
| Compound Name | 4-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline |
|---|---|
| PubChem CID | 117158440 |
| Molecular Formula | C13H10BrN3 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 4-(6-bromoimidazo[1,5-a]pyridin-3-yl)aniline |
| SMILES | Nc1ccc(-c2ncc3ccc(Br)cn23)cc1 |
| InChI | InChI=1S/C13H10BrN3/c14-10-3-6-12-7-16-13(17(12)8-10)9-1-4-11(15)5-2-9/h1-8H,15H2 |
| InChIKey | JGRLTJFIKWJLGY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|