C28H48O6 — CID 101427307
[(2R,3R,4R,5R,6S)-2-[(3S)-5-[(1R,4aR,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentoxy]-4,5-dihydroxy-6-methyloxan-3-yl] acetate (PubChem CID 101427307) has the molecular formula C28H48O6 and a molecular weight of 480.69 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-2-[(3S)-5-[(1R,4aR,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentoxy]-4,5-dihydroxy-6-methyloxan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-2-[(3S)-5-[(1R,4aR,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentoxy]-4,5-dihydroxy-6-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 101427307 |
| Molecular Formula | C28H48O6 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-2-[(3S)-5-[(1R,4aR,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentoxy]-4,5-dihydroxy-6-methyloxan-3-yl] acetate |
| SMILES | C=C1CC[C@@H]2C(C)(C)CCC[C@@]2(C)[C@@H]1CC[C@H](C)CCO[C@@H]1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H48O6/c1-17(13-16-32-26-25(34-20(4)29)24(31)23(30)19(3)33-26)9-11-21-18(2)10-12-22-27(5,6)14-8-15-28(21,22)7/h17,19,21-26,30-31H,2,8-16H2,1,3-7H3/t17-,19-,21+,22+,23-,24+,25+,26+,28-/m0/s1 |
| InChIKey | PKESFOWCFUJEIO-MJZVDEJTSA-N |
| XLogP | 5.01 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|