C23H34O3 — CID 163067392
[2-[2-(5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)ethyl]furan-3-yl]methyl acetate (PubChem CID 163067392) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is [2-[2-(5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)ethyl]furan-3-yl]methyl acetate.
| Compound Name | [2-[2-(5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)ethyl]furan-3-yl]methyl acetate |
|---|---|
| PubChem CID | 163067392 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | [2-[2-(5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)ethyl]furan-3-yl]methyl acetate |
| SMILES | C=C1CCC2C(C)(C)CCCC2(C)C1CCc1occc1COC(C)=O |
| InChI | InChI=1S/C23H34O3/c1-16-7-10-21-22(3,4)12-6-13-23(21,5)19(16)8-9-20-18(11-14-25-20)15-26-17(2)24/h11,14,19,21H,1,6-10,12-13,15H2,2-5H3 |
| InChIKey | RKLNNMGJYWCKNZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|