C40H49O8P — CID 101428101
[4-[9-(oxiran-2-yl)nonanoyloxy]-3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)phenyl] 9-(oxiran-2-yl)nonanoate (PubChem CID 101428101) has the molecular formula C40H49O8P and a molecular weight of 688.80 g/mol. Its IUPAC name is [4-[9-(oxiran-2-yl)nonanoyloxy]-3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)phenyl] 9-(oxiran-2-yl)nonanoate.
| Compound Name | [4-[9-(oxiran-2-yl)nonanoyloxy]-3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)phenyl] 9-(oxiran-2-yl)nonanoate |
|---|---|
| PubChem CID | 101428101 |
| Molecular Formula | C40H49O8P |
| Molecular Weight | 688.80 g/mol |
| Exact Mass | 688.32 |
| IUPAC Name | [4-[9-(oxiran-2-yl)nonanoyloxy]-3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)phenyl] 9-(oxiran-2-yl)nonanoate |
| SMILES | O=C(CCCCCCCCC1CO1)Oc1ccc(OC(=O)CCCCCCCCC2CO2)c(P2(=O)Oc3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C40H49O8P/c41-39(23-11-7-3-1-5-9-17-31-28-44-31)46-30-25-26-36(47-40(42)24-12-8-4-2-6-10-18-32-29-45-32)38(27-30)49(43)37-22-16-14-20-34(37)33-19-13-15-21-35(33)48-49/h13-16,19-22,25-27,31-32H,1-12,17-18,23-24,28-29H2 |
| InChIKey | BXBIQYSSCLYJSM-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 103.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.80 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|