C27H19O4P — CID 59523801
7-methyl-2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)anthracene-1,4-diol (PubChem CID 59523801) has the molecular formula C27H19O4P and a molecular weight of 438.42 g/mol. Its IUPAC name is 7-methyl-2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)anthracene-1,4-diol.
| Compound Name | 7-methyl-2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)anthracene-1,4-diol |
|---|---|
| PubChem CID | 59523801 |
| Molecular Formula | C27H19O4P |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 7-methyl-2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)anthracene-1,4-diol |
| SMILES | Cc1ccc2cc3c(O)cc(P4(=O)Oc5ccccc5-c5ccccc54)c(O)c3cc2c1 |
| InChI | InChI=1S/C27H19O4P/c1-16-10-11-17-13-21-22(14-18(17)12-16)27(29)26(15-23(21)28)32(30)25-9-5-3-7-20(25)19-6-2-4-8-24(19)31-32/h2-15,28-29H,1H3 |
| InChIKey | PURKRGZWUDZNHH-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|