C30H22O5P2 — CID 102496741
2-diphenylphosphoryl-3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)benzene-1,4-diol (PubChem CID 102496741) has the molecular formula C30H22O5P2 and a molecular weight of 524.45 g/mol. Its IUPAC name is 2-diphenylphosphoryl-3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)benzene-1,4-diol.
| Compound Name | 2-diphenylphosphoryl-3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 102496741 |
| Molecular Formula | C30H22O5P2 |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | 2-diphenylphosphoryl-3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)benzene-1,4-diol |
| SMILES | O=P1(c2c(O)ccc(O)c2P(=O)(c2ccccc2)c2ccccc2)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C30H22O5P2/c31-25-19-20-26(32)30(29(25)36(33,21-11-3-1-4-12-21)22-13-5-2-6-14-22)37(34)28-18-10-8-16-24(28)23-15-7-9-17-27(23)35-37/h1-20,31-32H |
| InChIKey | JAGGUFXUBLAXOR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|