C24H18Cl2O3P2 — CID 158016328
6-chlorobenzo[c][2,1]benzoxaphosphinine 6-oxide;[chloro(phenyl)phosphoryl]benzene (PubChem CID 158016328) has the molecular formula C24H18Cl2O3P2 and a molecular weight of 487.26 g/mol. Its IUPAC name is 6-chlorobenzo[c][2,1]benzoxaphosphinine 6-oxide;[chloro(phenyl)phosphoryl]benzene.
| Compound Name | 6-chlorobenzo[c][2,1]benzoxaphosphinine 6-oxide;[chloro(phenyl)phosphoryl]benzene |
|---|---|
| PubChem CID | 158016328 |
| Molecular Formula | C24H18Cl2O3P2 |
| Molecular Weight | 487.26 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | 6-chlorobenzo[c][2,1]benzoxaphosphinine 6-oxide;[chloro(phenyl)phosphoryl]benzene |
| SMILES | O=P(Cl)(c1ccccc1)c1ccccc1.O=P1(Cl)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C12H8ClO2P.C12H10ClOP/c13-16(14)12-8-4-2-6-10(12)9-5-1-3-7-11(9)15-16;13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-8H;1-10H |
| InChIKey | FFMYMYNFMYCQGG-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.26 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|