C18H15O2P — CID 151320639
6-cyclohexa-1,4-dien-1-ylbenzo[c][2,1]benzoxaphosphinine 6-oxide (PubChem CID 151320639) has the molecular formula C18H15O2P and a molecular weight of 294.29 g/mol. Its IUPAC name is 6-cyclohexa-1,4-dien-1-ylbenzo[c][2,1]benzoxaphosphinine 6-oxide.
| Compound Name | 6-cyclohexa-1,4-dien-1-ylbenzo[c][2,1]benzoxaphosphinine 6-oxide |
|---|---|
| PubChem CID | 151320639 |
| Molecular Formula | C18H15O2P |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 6-cyclohexa-1,4-dien-1-ylbenzo[c][2,1]benzoxaphosphinine 6-oxide |
| SMILES | O=P1(C2=CCC=CC2)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H15O2P/c19-21(14-8-2-1-3-9-14)18-13-7-5-11-16(18)15-10-4-6-12-17(15)20-21/h1-2,4-7,9-13H,3,8H2 |
| InChIKey | OGJODCAXQQGTBH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|