About (2S)-2,6-diazidohexanoic acid
(2S)-2,6-diazidohexanoic acid (PubChem CID 101430733) has the molecular formula C6H10N6O2
and a molecular weight of 198.19 g/mol. Its IUPAC name is (2S)-2,6-diazidohexanoic acid.
Molecular Properties
| Compound Name | (2S)-2,6-diazidohexanoic acid |
| PubChem CID | 101430733 |
| Molecular Formula | C6H10N6O2 |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (2S)-2,6-diazidohexanoic acid |
| SMILES | [N-]=[N+]=NCCCC[C@H](N=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C6H10N6O2/c7-11-9-4-2-1-3-5(6(13)14)10-12-8/h5H,1-4H2,(H,13,14)/t5-/m0/s1 |
| InChIKey | WBDHJLJZJBUUAM-YFKPBYRVSA-N |
| XLogP | 2.23 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,6-diazidohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,6-diazidohexanoic acid?
The IUPAC name of (2S)-2,6-diazidohexanoic acid (CID 101430733) is (2S)-2,6-diazidohexanoic acid.
What is the SMILES notation for (2S)-2,6-diazidohexanoic acid?
The canonical SMILES for (2S)-2,6-diazidohexanoic acid is [N-]=[N+]=NCCCC[C@H](N=[N+]=[N-])C(=O)O.
What is the InChIKey of (2S)-2,6-diazidohexanoic acid?
The InChIKey is WBDHJLJZJBUUAM-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H10N6O2/c7-11-9-4-2-1-3-5(6(13)14)10-12-8/h5H,1-4H2,(H,13,14)/t5-/m0/s1.
What are the key properties of (2S)-2,6-diazidohexanoic acid?
(2S)-2,6-diazidohexanoic acid has a molecular weight of 198.19 g/mol, XLogP of 2.23, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,6-diazidohexanoic acid is sourced from PubChem (CID 101430733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).