C15H29N3O — CID 146777292
8-azido-4-(2,2-dimethylpropyl)-2,2-dimethyloctan-3-one (PubChem CID 146777292) has the molecular formula C15H29N3O and a molecular weight of 267.42 g/mol. Its IUPAC name is 8-azido-4-(2,2-dimethylpropyl)-2,2-dimethyloctan-3-one.
| Compound Name | 8-azido-4-(2,2-dimethylpropyl)-2,2-dimethyloctan-3-one |
|---|---|
| PubChem CID | 146777292 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | 8-azido-4-(2,2-dimethylpropyl)-2,2-dimethyloctan-3-one |
| SMILES | CC(C)(C)CC(CCCCN=[N+]=[N-])C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H29N3O/c1-14(2,3)11-12(13(19)15(4,5)6)9-7-8-10-17-18-16/h12H,7-11H2,1-6H3 |
| InChIKey | RSYYIBDZNVOMAW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|