C16H33NO — CID 159239549
(4R)-4-(2,2-dimethylpropyl)-2,2-dimethyl-8-(methylamino)octan-3-one (PubChem CID 159239549) has the molecular formula C16H33NO and a molecular weight of 255.45 g/mol. Its IUPAC name is (4R)-4-(2,2-dimethylpropyl)-2,2-dimethyl-8-(methylamino)octan-3-one.
| Compound Name | (4R)-4-(2,2-dimethylpropyl)-2,2-dimethyl-8-(methylamino)octan-3-one |
|---|---|
| PubChem CID | 159239549 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | (4R)-4-(2,2-dimethylpropyl)-2,2-dimethyl-8-(methylamino)octan-3-one |
| SMILES | CNCCCC[C@H](CC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C16H33NO/c1-15(2,3)12-13(10-8-9-11-17-7)14(18)16(4,5)6/h13,17H,8-12H2,1-7H3/t13-/m1/s1 |
| InChIKey | DMELSKCTBVWMAN-CYBMUJFWSA-N |
| XLogP | 4.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|