C8H16O2S2 — CID 101432647
[(2R)-1-hydroxy-3,3-dimethylbutan-2-yl]sulfanyl-methylsulfanylmethanone (PubChem CID 101432647) has the molecular formula C8H16O2S2 and a molecular weight of 208.35 g/mol. Its IUPAC name is [(2R)-1-hydroxy-3,3-dimethylbutan-2-yl]sulfanyl-methylsulfanylmethanone.
| Compound Name | [(2R)-1-hydroxy-3,3-dimethylbutan-2-yl]sulfanyl-methylsulfanylmethanone |
|---|---|
| PubChem CID | 101432647 |
| Molecular Formula | C8H16O2S2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | [(2R)-1-hydroxy-3,3-dimethylbutan-2-yl]sulfanyl-methylsulfanylmethanone |
| SMILES | CSC(=O)S[C@@H](CO)C(C)(C)C |
| InChI | InChI=1S/C8H16O2S2/c1-8(2,3)6(5-9)12-7(10)11-4/h6,9H,5H2,1-4H3/t6-/m0/s1 |
| InChIKey | LJFUGRBROMWNMF-LURJTMIESA-N |
| XLogP | 2.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|